Difference between revisions of "CPD-6442"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...") |
(Created page with "Category:metabolite == Metabolite CPD-6442 == * common-name: ** methylsalicylate * smiles: ** coc(c1(c=cc=cc=1o))=o * inchi-key: ** oswpmrlsedhdff-uhfffaoysa-n * molecular...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6442 == |
* common-name: | * common-name: | ||
| − | ** | + | ** methylsalicylate |
* smiles: | * smiles: | ||
| − | ** | + | ** coc(c1(c=cc=cc=1o))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oswpmrlsedhdff-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 152.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNQT-4366]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methylsalicylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oswpmrlsedhdff-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.149}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-6442
- common-name:
- methylsalicylate
- smiles:
- coc(c1(c=cc=cc=1o))=o
- inchi-key:
- oswpmrlsedhdff-uhfffaoysa-n
- molecular-weight:
- 152.149
