Difference between revisions of "CPD-650"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9280 RXN-9280] == * direction: ** left-to-right * common-name: ** octaprenyldihydroxybenzoate m...")
(Created page with "Category:metabolite == Metabolite CPD-650 == * common-name: ** (3r)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9280 RXN-9280] ==
+
== Metabolite CPD-650 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** octaprenyldihydroxybenzoate methyltransferase
+
** (3r)-3-hydroxybutanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.114 ec-2.1.1.114]
+
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
* synonymous:
+
* inchi-key:
** 3-octaprenyl-4,5-dihydroxybenzoate methyltransferase
+
** qhhkkmyhdbrony-wzzmxtmrsa-j
== Reaction formula ==
+
* molecular-weight:
* 1 [[CPD-9894]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-9899]][c] '''+''' 1 [[PROTON]][c]
+
** 849.593
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ13007]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-5901]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=(3r)-3-hydroxybutanoyl-coa}}
* [[PWY-5870]], ubiquinol-8 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870]
+
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-wzzmxtmrsa-j}}
** '''4''' reactions found over '''9''' reactions in the full pathway
+
{{#set: molecular-weight=849.593}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44485 44485]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=octaprenyldihydroxybenzoate methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.114}}
 
{{#set: synonymous=3-octaprenyl-4,5-dihydroxybenzoate methyltransferase}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-650

  • common-name:
    • (3r)-3-hydroxybutanoyl-coa
  • smiles:
    • cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • qhhkkmyhdbrony-wzzmxtmrsa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality