Difference between revisions of "CPD-650"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9280 RXN-9280] == * direction: ** left-to-right * common-name: ** octaprenyldihydroxybenzoate m...") |
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DI-H-OROTATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-dihydroorotate |
| − | * | + | * smiles: |
| − | ** [ | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ufivepvsagbusi-reohclbhsa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 157.105 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[DIHYDROOROT-RXN]] |
| − | * | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| − | * | + | * [[RXN0-6491]] |
| − | == | + | * [[RXN0-6554]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DIHYDROOROT-RXN]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=(s)-dihydroorotate}} | |
| − | + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} | |
| − | + | {{#set: molecular-weight=157.105}} | |
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105
