Difference between revisions of "CPD-659"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LAUROYLCOA-CPD == * common-name: ** lauroyl-coa * smiles: ** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-659 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-arogenate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mieildywganznh-dsquftabsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 226.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| − | + | * [[PREPHENATE-TRANSAMINE-RXN]] | |
| − | + | * [[RXN-5682]] | |
| − | * [[RXN | ||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| − | * [[ | + | * [[PREPHENATE-TRANSAMINE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-arogenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.208}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-659
- common-name:
- l-arogenate
- smiles:
- c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
- inchi-key:
- mieildywganznh-dsquftabsa-m
- molecular-weight:
- 226.208
