Difference between revisions of "CPD-659"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10981 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-9839 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-659 == |
| − | == | + | * common-name: |
| − | * | + | ** l-arogenate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[RXN | + | ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o |
| − | * | + | * inchi-key: |
| − | * | + | ** mieildywganznh-dsquftabsa-m |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 226.208 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| − | + | * [[PREPHENATE-TRANSAMINE-RXN]] | |
| − | {{#set: | + | * [[RXN-5682]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| + | * [[PREPHENATE-TRANSAMINE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=l-arogenate}} | ||
| + | {{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}} | ||
| + | {{#set: molecular-weight=226.208}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-659
- common-name:
- l-arogenate
- smiles:
- c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
- inchi-key:
- mieildywganznh-dsquftabsa-m
- molecular-weight:
- 226.208
