Difference between revisions of "CPD-661"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-661 == * common-name: ** propynoate * smiles: ** c#cc([o-])=o * inchi-key: ** uorvclmrjxcdcp-uhfffaoysa-m * molecular-weight: ** 69.0...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-661 == |
* common-name: | * common-name: | ||
| − | ** | + | ** propynoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c#cc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uorvclmrjxcdcp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 69.04 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14224]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=propynoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uorvclmrjxcdcp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=69.04}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-661
- common-name:
- propynoate
- smiles:
- c#cc([o-])=o
- inchi-key:
- uorvclmrjxcdcp-uhfffaoysa-m
- molecular-weight:
- 69.04
