Difference between revisions of "CPD-663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-containing-5-taurinomethyluridine == * common-name: ** a 5-taurinomethyluridine in trna == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-663 == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-663 == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-4-dehydro-6-deoxy-α-d-glucose |
| + | * smiles: | ||
| + | ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3) | ||
| + | * inchi-key: | ||
| + | ** ddwgqqadoimfoi-jphisprksa-l | ||
| + | * molecular-weight: | ||
| + | ** 546.274 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18332]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18332]] | ||
| + | * [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}} |
| + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}} | ||
| + | {{#set: molecular-weight=546.274}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-663
- common-name:
- udp-4-dehydro-6-deoxy-α-d-glucose
- smiles:
- cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
- inchi-key:
- ddwgqqadoimfoi-jphisprksa-l
- molecular-weight:
- 546.274
