|
|
| (7 intermediate revisions by 2 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE-SYN-RXN GLUTATHIONE-SYN-RXN] == | + | == Metabolite CPD-663 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** glutathione synthetase | + | ** udp-4-dehydro-6-deoxy-α-d-glucose |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.2.3 ec-6.3.2.3] | + | ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[L-GAMMA-GLUTAMYLCYSTEINE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GLUTATHIONE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
| + | ** ddwgqqadoimfoi-jphisprksa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ10036]] | + | ** 546.274 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-18332]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-18332]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | == Pathway(s) == | + | {{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}} |
| − | * [[GLUTATHIONESYN-PWY]], glutathione biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONESYN-PWY GLUTATHIONESYN-PWY] | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}} |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | {{#set: molecular-weight=546.274}} |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13558 13558]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00497 R00497]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTJ6 Q9JTJ6]
| |
| − | ** [http://www.uniprot.org/uniprot/P46413 P46413]
| |
| − | ** [http://www.uniprot.org/uniprot/P45480 P45480]
| |
| − | ** [http://www.uniprot.org/uniprot/P35667 P35667]
| |
| − | ** [http://www.uniprot.org/uniprot/P35669 P35669]
| |
| − | ** [http://www.uniprot.org/uniprot/P35668 P35668]
| |
| − | ** [http://www.uniprot.org/uniprot/P48637 P48637]
| |
| − | ** [http://www.uniprot.org/uniprot/P46416 P46416]
| |
| − | ** [http://www.uniprot.org/uniprot/P51855 P51855]
| |
| − | ** [http://www.uniprot.org/uniprot/P73493 P73493]
| |
| − | ** [http://www.uniprot.org/uniprot/P04425 P04425]
| |
| − | ** [http://www.uniprot.org/uniprot/O22494 O22494]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=glutathione synthetase}} | |
| − | {{#set: ec-number=ec-6.3.2.3}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
| |
