Difference between revisions of "CPD-665"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-665 == * common-name: ** 1-propanal * smiles: ** cc[ch]=o * inchi-key: ** nbbjymsmwiiqgu-uhfffaoysa-n * molecular-weight: ** 58.08 ==...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-665 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-propanal |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nbbjymsmwiiqgu-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 58.08 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13198]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13198]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-propanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nbbjymsmwiiqgu-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=58.08}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-665
- common-name:
- 1-propanal
- smiles:
- cc[ch]=o
- inchi-key:
- nbbjymsmwiiqgu-uhfffaoysa-n
- molecular-weight:
- 58.08
