Difference between revisions of "CPD-665"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](...")
(Created page with "Category:metabolite == Metabolite CPD-665 == * common-name: ** 1-propanal * smiles: ** cc[ch]=o * inchi-key: ** nbbjymsmwiiqgu-uhfffaoysa-n * molecular-weight: ** 58.08 ==...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13713 ==
+
== Metabolite CPD-665 ==
 
* common-name:
 
* common-name:
** adenosine 5'-phosphoselenate
+
** 1-propanal
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
+
** cc[ch]=o
 
* inchi-key:
 
* inchi-key:
** xcadvmzzfpierr-kqynxxcusa-m
+
** nbbjymsmwiiqgu-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 473.174
+
** 58.08
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13198]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12720]]
+
* [[RXN-13198]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 5'-phosphoselenate}}
+
{{#set: common-name=1-propanal}}
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=nbbjymsmwiiqgu-uhfffaoysa-n}}
{{#set: molecular-weight=473.174}}
+
{{#set: molecular-weight=58.08}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-665

  • common-name:
    • 1-propanal
  • smiles:
    • cc[ch]=o
  • inchi-key:
    • nbbjymsmwiiqgu-uhfffaoysa-n
  • molecular-weight:
    • 58.08

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality