Difference between revisions of "CPD-6661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYLAMINE == * common-name: ** dimethylamine * smiles: ** c[n+]c * inchi-key: ** rosdsfdqcjngol-uhfffaoysa-o * molecular-weight: ** 4...")
(Created page with "Category:metabolite == Metabolite CPD-6661 == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYLAMINE ==
+
== Metabolite CPD-6661 ==
 
* common-name:
 
* common-name:
** dimethylamine
+
** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
 
* smiles:
 
* smiles:
** c[n+]c
+
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** rosdsfdqcjngol-uhfffaoysa-o
+
** ctpqaxvnygzuaj-qwbqgljisa-d
 
* molecular-weight:
 
* molecular-weight:
** 46.092
+
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7186]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHYLARGININASE-RXN]]
+
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dimethylamine}}
+
{{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}}
{{#set: inchi-key=inchikey=rosdsfdqcjngol-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}}
{{#set: molecular-weight=46.092}}
+
{{#set: molecular-weight=569.977}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-6661

  • common-name:
    • 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-qwbqgljisa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality