Difference between revisions of "CPD-6661"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01931 == * transcription-direction: ** negative * right-end-position: ** 109831 * left-end-position: ** 104908 * centisome-position: ** 72.97339...") |
(Created page with "Category:metabolite == Metabolite CPD-6661 == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-6661 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate |
| − | + | * smiles: | |
| − | + | ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | |
| − | + | * inchi-key: | |
| − | + | ** ctpqaxvnygzuaj-qwbqgljisa-d | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 569.977 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-7186]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-7186]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}} |
| − | * | + | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}} |
| − | * | + | {{#set: molecular-weight=569.977}} |
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-6661
- common-name:
- 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
- smiles:
- c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-qwbqgljisa-d
- molecular-weight:
- 569.977
