Difference between revisions of "CPD-6661"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite N6-Methyladenine-containing-mRNAs == * common-name: ** an n6-methyladenine in mrna == Reaction(s) known to consume the compound == * RX...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N6-Methyladenine-containing-mRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n6-methyladenine in mrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17811]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17811]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n6-methyladenine in mrna}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite N6-Methyladenine-containing-mRNAs
- common-name:
- an n6-methyladenine in mrna
