Difference between revisions of "CPD-667"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22164 == * transcription-direction: ** negative * right-end-position: ** 452949 * left-end-position: ** 448768 * centisome-position: ** 76.914825...") |
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-667 == |
| − | * | + | * common-name: |
| − | ** | + | ** o-acetyl-l-homoserine |
| − | * | + | * smiles: |
| − | ** | + | ** cc(occc(c([o-])=o)[n+])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fcxzbwsiaggpcb-yfkpbyrvsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 161.157 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[ACETYLHOMOSER-CYS-RXN]] | |
| − | == Reaction(s) | + | * [[ACHMSSELCYSL]] |
| − | * [[ | + | * [[ACHMSSELCYSLh]] |
| − | * | + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| − | + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=o-acetyl-l-homoserine}} | |
| − | + | {{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}} | |
| − | + | {{#set: molecular-weight=161.157}} | |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-667
- common-name:
- o-acetyl-l-homoserine
- smiles:
- cc(occc(c([o-])=o)[n+])=o
- inchi-key:
- fcxzbwsiaggpcb-yfkpbyrvsa-n
- molecular-weight:
- 161.157
