Difference between revisions of "CPD-667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18494 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)...")
(Created page with "Category:metabolite == Metabolite QUEUINE == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) * inchi-key: ** wyrolenthwjflr-acldm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18494 ==
+
== Metabolite QUEUINE ==
 
* common-name:
 
* common-name:
** 3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** queuine
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
 
* inchi-key:
 
* inchi-key:
** uiagujimvqpsdp-qojzhlsosa-j
+
** wyrolenthwjflr-acldmzeesa-o
 
* molecular-weight:
 
* molecular-weight:
** 1118.034
+
** 278.29
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17116]]
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=queuine}}
{{#set: inchi-key=inchikey=uiagujimvqpsdp-qojzhlsosa-j}}
+
{{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}}
{{#set: molecular-weight=1118.034}}
+
{{#set: molecular-weight=278.29}}

Revision as of 13:07, 14 January 2021

Metabolite QUEUINE

  • common-name:
    • queuine
  • smiles:
    • c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
  • inchi-key:
    • wyrolenthwjflr-acldmzeesa-o
  • molecular-weight:
    • 278.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality