Difference between revisions of "CPD-667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite QUEUINE == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) * inchi-key: ** wyrolenthwjflr-acldm...")
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfonate == * common-name: ** an n-terminal 3-sulfo-l-alanyl-[protein] == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite QUEUINE ==
+
== Metabolite N-terminal-L-cysteine-sulfonate ==
 
* common-name:
 
* common-name:
** queuine
+
** an n-terminal 3-sulfo-l-alanyl-[protein]
* smiles:
 
** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
 
* inchi-key:
 
** wyrolenthwjflr-acldmzeesa-o
 
* molecular-weight:
 
** 278.29
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* [[RXN-17891]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=queuine}}
+
{{#set: common-name=an n-terminal 3-sulfo-l-alanyl-[protein]}}
{{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}}
 
{{#set: molecular-weight=278.29}}
 

Revision as of 18:52, 14 January 2021

Metabolite N-terminal-L-cysteine-sulfonate

  • common-name:
    • an n-terminal 3-sulfo-l-alanyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal 3-sulfo-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.