Difference between revisions of "CPD-6701"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...") |
(Created page with "Category:metabolite == Metabolite CPD-6701 == * common-name: ** 1d-myo-inositol 5-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inchi-key: ** in...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6701 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1d-myo-inositol 5-monophosphate |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-]) | + | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** inapmgsxuvuwaf-kxxvrosksa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-10953]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 5-monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-6701
- common-name:
- 1d-myo-inositol 5-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-kxxvrosksa-l
- molecular-weight:
- 258.121
