Difference between revisions of "CPD-6701"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10794 == * transcription-direction: ** positive * right-end-position: ** 314960 * left-end-position: ** 295807 * centisome-position: ** 77.13089...")
(Created page with "Category:metabolite == Metabolite CPD-6701 == * common-name: ** 1d-myo-inositol 5-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inchi-key: ** in...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10794 ==
+
== Metabolite CPD-6701 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1d-myo-inositol 5-monophosphate
−
* right-end-position:
+
* smiles:
−
** 314960
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 295807
+
** inapmgsxuvuwaf-kxxvrosksa-l
−
* centisome-position:
+
* molecular-weight:
−
** 77.13089   
+
** 258.121
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10953]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[HOMOCYSMET-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1d-myo-inositol 5-monophosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=258.121}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12730]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5041]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[HSERMETANA-PWY]]
 
−
** '''3''' reactions found over '''2''' reactions in the full pathway
 
−
* [[HOMOSER-METSYN-PWY]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6151]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-702]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6936]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=314960}}
 
−
{{#set: left-end-position=295807}}
 
−
{{#set: centisome-position=77.13089    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-6701

  • common-name:
    • 1d-myo-inositol 5-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-kxxvrosksa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-6701&oldid=137308"