Difference between revisions of "CPD-6702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Beta-Hydroxysterols == * common-name: ** a 3β-hydroxysteroid == Reaction(s) known to consume the compound == * RXN-13686 == Re...")
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Beta-Hydroxysterols ==
+
== Metabolite THREO-DS-ISO-CITRATE ==
 
* common-name:
 
* common-name:
** a 3β-hydroxysteroid
+
** d-threo-isocitrate
 +
* smiles:
 +
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
 +
* inchi-key:
 +
** odblhexudapzau-zafykaaxsa-k
 +
* molecular-weight:
 +
** 189.101
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13686]]
+
* [[ACONITATEHYDR-RXN]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[RXN-14047]]
 +
* [[RXN-9951]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13686]]
+
* [[ACONITATEHYDR-RXN]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[RXN-14047]]
 +
* [[RXN-9951]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3β-hydroxysteroid}}
+
{{#set: common-name=d-threo-isocitrate}}
 +
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
 +
{{#set: molecular-weight=189.101}}

Revision as of 13:08, 14 January 2021

Metabolite THREO-DS-ISO-CITRATE

  • common-name:
    • d-threo-isocitrate
  • smiles:
    • c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
  • inchi-key:
    • odblhexudapzau-zafykaaxsa-k
  • molecular-weight:
    • 189.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality