Difference between revisions of "CPD-671"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
(Created page with "Category:metabolite == Metabolite CPD-671 == * common-name: ** a 5-formiminotetrahydrofolate == Reaction(s) known to consume the compound == == Reaction(s) known to produc...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-OCTAPRENYLPHENOL ==
+
== Metabolite CPD-671 ==
 
* common-name:
 
* common-name:
** 2-octaprenylphenol
+
** a 5-formiminotetrahydrofolate
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** vunqjppptjiren-cmaxttdksa-n
 
* molecular-weight:
 
** 639.058
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-octaprenylphenol}}
+
{{#set: common-name=a 5-formiminotetrahydrofolate}}
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
 
{{#set: molecular-weight=639.058}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-671

  • common-name:
    • a 5-formiminotetrahydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality