Difference between revisions of "CPD-674"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == * direction: ** left-to-right * common-name: ** γ-glutamyltransferase *...")
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * molec...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] ==
+
== Metabolite CPD-674 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** γ-glutamyltransferase
+
** trans-cinnamate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.2.2 ec-2.3.2.2]
+
** c(=o)([o-])c=cc1(=cc=cc=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Amino-Acids-20]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c] '''+''' 1 [[CYS-GLY]][c]
+
** wbywaxjhaxsjni-votsokgwsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ08599]]
+
** 147.153
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-2001]]
−
** Category: [[orthology]]
+
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ08598]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=trans-cinnamate}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=147.153}}
−
* [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041]
 
−
** '''5''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=γ-glutamyltransferase}}
 
−
{{#set: ec-number=ec-2.3.2.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-674

  • common-name:
    • trans-cinnamate
  • smiles:
    • c(=o)([o-])c=cc1(=cc=cc=c1)
  • inchi-key:
    • wbywaxjhaxsjni-votsokgwsa-m
  • molecular-weight:
    • 147.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-674&oldid=139453"