Difference between revisions of "CPD-6746"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...") |
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-6746 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1d-myo-inositol 2-monophosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** inapmgsxuvuwaf-qwbqgljisa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7253]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 2-monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-qwbqgljisa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-6746
- common-name:
- 1d-myo-inositol 2-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-qwbqgljisa-l
- molecular-weight:
- 258.121
