Difference between revisions of "CPD-676"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCV3 TCV3] == * direction: ** reversible == Reaction formula == * 1.0 NITRATE[C_c] '''<=>''' 1....")
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCV3 TCV3] ==
+
== Metabolite CPD-676 ==
−
* direction:
+
* common-name:
−
** reversible
+
** trans-caffeate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[NITRATE]][C_c] '''<=>''' 1.0 [[NITRATE]][C_v]
+
** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ05424]]
+
** qaiprvgongvqas-duxpyhpusa-m
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 179.152
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ05427]]
+
* [[RXN-1104]]
−
** Category: [[orthology]]
+
* [[RXN-1126]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ05431]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=trans-caffeate}}
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=179.152}}
−
* Gene: [[SJ05426]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-676

  • common-name:
    • trans-caffeate
  • smiles:
    • c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
  • inchi-key:
    • qaiprvgongvqas-duxpyhpusa-m
  • molecular-weight:
    • 179.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-676&oldid=139719"