Difference between revisions of "CPD-676"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-MN+2 TransportSeed-MN+2] == * direction: ** left-to-right == Reaction formula == * 1....") |
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-676 == |
− | * | + | * common-name: |
− | ** | + | ** trans-caffeate |
− | + | * smiles: | |
− | * | + | ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) |
− | == | + | * inchi-key: |
− | == | + | ** qaiprvgongvqas-duxpyhpusa-m |
− | + | * molecular-weight: | |
− | * | + | ** 179.152 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-1104]] | |
− | + | * [[RXN-1126]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=trans-caffeate}} |
− | + | {{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=179.152}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-676
- common-name:
- trans-caffeate
- smiles:
- c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
- inchi-key:
- qaiprvgongvqas-duxpyhpusa-m
- molecular-weight:
- 179.152