Difference between revisions of "CPD-678"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-678 == * common-name: ** hydrogen selenide * smiles: ** [seh2] * inchi-key: ** spvxkvoxsxtjoy-uhfffaoysa-n * molecular-weight: ** 80....") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-678 == |
* common-name: | * common-name: | ||
− | ** | + | ** hydrogen selenide |
* smiles: | * smiles: | ||
− | ** | + | ** [seh2] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** spvxkvoxsxtjoy-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 80.976 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12726]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hydrogen selenide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=spvxkvoxsxtjoy-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=80.976}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-678
- common-name:
- hydrogen selenide
- smiles:
- [seh2]
- inchi-key:
- spvxkvoxsxtjoy-uhfffaoysa-n
- molecular-weight:
- 80.976