Difference between revisions of "CPD-68"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20012 == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) * inchi-key: ** yqhmwtpy...") |
(Created page with "Category:metabolite == Metabolite CPD-68 == * common-name: ** 1-aminocyclopropane-1-carboxylate * smiles: ** c([o-])(=o)c1(cc1)[n+] * inchi-key: ** pajpwumxbyxfcz-uhfffaoy...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-68 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-aminocyclopropane-1-carboxylate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c1(cc1)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pajpwumxbyxfcz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 101.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4.1.99.4-RXN]] |
| + | * [[ETHYL-RXN]] | ||
| + | * [[RXN-15149]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.4.1.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-aminocyclopropane-1-carboxylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pajpwumxbyxfcz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=101.105}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-68
- common-name:
- 1-aminocyclopropane-1-carboxylate
- smiles:
- c([o-])(=o)c1(cc1)[n+]
- inchi-key:
- pajpwumxbyxfcz-uhfffaoysa-n
- molecular-weight:
- 101.105
