Difference between revisions of "CPD-69"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite CPD66-39 == * common-name: ** a 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound == * ACYLCOASYN-RXN * TRANS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite CPD66-39 ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** a 2,3,4-saturated fatty acid
* smiles:
 
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
 
* inchi-key:
 
** pqmcqnovnfnpfj-hyimlasbsa-k
 
* molecular-weight:
 
** 264.169
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
+
* [[ACYLCOASYN-RXN]]
 +
* [[TRANS-RXN0-623]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIAZOLSYN2-RXN]]
+
* [[THIOESTER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=a 2,3,4-saturated fatty acid}}
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
 
{{#set: molecular-weight=264.169}}
 

Revision as of 11:14, 15 January 2021

Metabolite CPD66-39

  • common-name:
    • a 2,3,4-saturated fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality