Difference between revisions of "CPD-690"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite UDP-D-XYLOSE ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** udp-α-d-xylose
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
+
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
 
* inchi-key:
 
* inchi-key:
** buzogvvqwcxxdp-vpeninkcsa-j
+
** dqqdlyvhotzlor-ocimbmbzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 519.151
+
** 534.263
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11396]]
+
* [[2.4.2.26-RXN]]
* [[RXN-14205]]
+
* [[2.4.2.38-RXN]]
 +
* [[2.7.7.11-RXN]]
 +
* [[RXN-9104]]
 +
* [[UA4E]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14205]]
+
* [[2.7.7.11-RXN]]
 +
* [[UA4E]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UGDC]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=udp-α-d-xylose}}
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
+
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=534.263}}

Revision as of 15:30, 5 January 2021

Metabolite UDP-D-XYLOSE

  • common-name:
    • udp-α-d-xylose
  • smiles:
    • c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
  • inchi-key:
    • dqqdlyvhotzlor-ocimbmbzsa-l
  • molecular-weight:
    • 534.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality