Difference between revisions of "CPD-693"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite biotin-L-lysine-in-BCCP-dimers == * common-name: ** a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CPD-693 == * common-name: ** 2-cis-abscisate * smiles: ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** jlidbldqvayhne-ykal...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-693 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-cis-abscisate |
| + | * smiles: | ||
| + | ** cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o | ||
| + | * inchi-key: | ||
| + | ** jlidbldqvayhne-ykalocixsa-m | ||
| + | * molecular-weight: | ||
| + | ** 263.313 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.2.3.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-cis-abscisate}} |
| + | {{#set: inchi-key=inchikey=jlidbldqvayhne-ykalocixsa-m}} | ||
| + | {{#set: molecular-weight=263.313}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-693
- common-name:
- 2-cis-abscisate
- smiles:
- cc(=cc([o-])=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
- inchi-key:
- jlidbldqvayhne-ykalocixsa-m
- molecular-weight:
- 263.313
