Difference between revisions of "CPD-695"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc...")
(Created page with "Category:metabolite == Metabolite CPD-9446 == * common-name: ** 1,5-anhydro-d-mannitol * smiles: ** c(o)c1(occ(o)c(o)c(o)1) * inchi-key: ** mpcajmnynogxpb-kvtdhhqdsa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11520 ==
+
== Metabolite CPD-9446 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
+
** 1,5-anhydro-d-mannitol
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c(o)c1(occ(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** yyccmactoajggw-ozvhgmpnsa-j
+
** mpcajmnynogxpb-kvtdhhqdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1053.904
+
** 164.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10699]]
+
* [[RXN-13064]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10698]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
+
{{#set: common-name=1,5-anhydro-d-mannitol}}
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
+
{{#set: inchi-key=inchikey=mpcajmnynogxpb-kvtdhhqdsa-n}}
{{#set: molecular-weight=1053.904}}
+
{{#set: molecular-weight=164.158}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-9446

  • common-name:
    • 1,5-anhydro-d-mannitol
  • smiles:
    • c(o)c1(occ(o)c(o)c(o)1)
  • inchi-key:
    • mpcajmnynogxpb-kvtdhhqdsa-n
  • molecular-weight:
    • 164.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality