Difference between revisions of "CPD-695"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc...")
(Created page with "Category:metabolite == Metabolite CPD-695 == * common-name: ** gibberellin a53 * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11520 ==
+
== Metabolite CPD-695 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
+
** gibberellin a53
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** yyccmactoajggw-ozvhgmpnsa-j
+
** czemyyicwzpenf-voltxkgxsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1053.904
+
** 346.422
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10699]]
+
* [[RXN1F-167]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10698]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
+
{{#set: common-name=gibberellin a53}}
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
+
{{#set: inchi-key=inchikey=czemyyicwzpenf-voltxkgxsa-l}}
{{#set: molecular-weight=1053.904}}
+
{{#set: molecular-weight=346.422}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-695

  • common-name:
    • gibberellin a53
  • smiles:
    • c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • czemyyicwzpenf-voltxkgxsa-l
  • molecular-weight:
    • 346.422

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality