Difference between revisions of "CPD-696"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UROCANATE == * common-name: ** urocanate * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inchi-key: ** loiymiarkyctbw-owojbtedsa-m * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite CPD-20693 == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-20693 == |
* common-name: | * common-name: | ||
| − | ** | + | ** diatoxanthin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hnyjhqmusvnwpv-drcjtwaysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 566.865 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-19202]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-19200]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=diatoxanthin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=566.865}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-20693
- common-name:
- diatoxanthin
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
- inchi-key:
- hnyjhqmusvnwpv-drcjtwaysa-n
- molecular-weight:
- 566.865
