Difference between revisions of "CPD-6972"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02681 == * transcription-direction: ** negative * right-end-position: ** 94579 * left-end-position: ** 84628 * centisome-position: ** 64.64693...") |
(Created page with "Category:metabolite == Metabolite CPD-6972 == * common-name: ** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa * smiles: ** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-6972 == |
− | * | + | * common-name: |
− | ** | + | ** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa |
− | * | + | * smiles: |
− | ** | + | ** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o |
− | * | + | * inchi-key: |
− | ** | + | ** kvaqapqxoxtrae-uhfffaoysa-i |
− | * | + | * molecular-weight: |
− | ** | + | ** 966.676 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[NAPHTHOATE-SYN-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[NPHS]] |
− | * | + | * [[O-SUCCINYLBENZOATE-COA-LIG-RXN]] |
− | + | * [[RXN-7614]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-(2'-carboxyphenyl)-4-oxobutyryl-coa}} | |
− | + | {{#set: inchi-key=inchikey=kvaqapqxoxtrae-uhfffaoysa-i}} | |
− | + | {{#set: molecular-weight=966.676}} | |
− | * | ||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-6972
- common-name:
- 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
- smiles:
- cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
- inchi-key:
- kvaqapqxoxtrae-uhfffaoysa-i
- molecular-weight:
- 966.676