Difference between revisions of "CPD-698"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...")
(Created page with "Category:metabolite == Metabolite CPD-698 == * common-name: ** campest-4-en-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) * in...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
+
== Metabolite CPD-698 ==
 
* common-name:
 
* common-name:
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
+
** campest-4-en-3-one
 
* smiles:
 
* smiles:
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** zrjhlgyvucpznh-mqwkrirwsa-o
+
** qqiopzfvtihasb-imudckkosa-n
 
* molecular-weight:
 
* molecular-weight:
** 205.276
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9896]]
+
* [[RXN-4231]]
 +
* [[RXN-711]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=campest-4-en-3-one}}
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
+
{{#set: inchi-key=inchikey=qqiopzfvtihasb-imudckkosa-n}}
{{#set: molecular-weight=205.276}}
+
{{#set: molecular-weight=398.671}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-698

  • common-name:
    • campest-4-en-3-one
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • qqiopzfvtihasb-imudckkosa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality