Difference between revisions of "CPD-6991"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)c...")
(Created page with "Category:metabolite == Metabolite CPD-17399 == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to consume the compound == * RXN-16157 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17264 ==
+
== Metabolite CPD-17399 ==
 
* common-name:
 
* common-name:
** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
+
** a [glycerolipid]-auricolate
* smiles:
 
** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** ptromslvpfeiqj-qpyoymcksa-j
 
* molecular-weight:
 
** 1047.943
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16157]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16021]]
+
* [[RXN-14491]]
 +
* [[RXN-16157]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
+
{{#set: common-name=a [glycerolipid]-auricolate}}
{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
 
{{#set: molecular-weight=1047.943}}
 

Revision as of 11:14, 15 January 2021

Metabolite CPD-17399

  • common-name:
    • a [glycerolipid]-auricolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-auricolate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.