Difference between revisions of "CPD-6991"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17399 == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to consume the compound == * RXN-16157 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) * inchi-key: ** urfcjeuyxna...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-6991 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-pinocembrin |
| + | * smiles: | ||
| + | ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) | ||
| + | * inchi-key: | ||
| + | ** urfcjeuyxnahfi-zdusscgksa-m | ||
| + | * molecular-weight: | ||
| + | ** 255.249 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7648]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7647]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-pinocembrin}} |
| + | {{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}} | ||
| + | {{#set: molecular-weight=255.249}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-6991
- common-name:
- (2s)-pinocembrin
- smiles:
- c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
- inchi-key:
- urfcjeuyxnahfi-zdusscgksa-m
- molecular-weight:
- 255.249
