Difference between revisions of "CPD-6991"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Mannosyl9-Nacetylglucosaminyl2 == == Reaction(s) known to consume the compound == * 3.2.1.113-RXN == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) * inchi-key: ** urfcjeuyxna...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Mannosyl9-Nacetylglucosaminyl2 ==
+
== Metabolite CPD-6991 ==
 +
* common-name:
 +
** (2s)-pinocembrin
 +
* smiles:
 +
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
 +
* inchi-key:
 +
** urfcjeuyxnahfi-zdusscgksa-m
 +
* molecular-weight:
 +
** 255.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.113-RXN]]
+
* [[RXN-7648]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7647]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(2s)-pinocembrin}}
 +
{{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}}
 +
{{#set: molecular-weight=255.249}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-6991

  • common-name:
    • (2s)-pinocembrin
  • smiles:
    • c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
  • inchi-key:
    • urfcjeuyxnahfi-zdusscgksa-m
  • molecular-weight:
    • 255.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality