Difference between revisions of "CPD-6992"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) * inchi-key: ** suyjzkrqhbq...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6992 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-pinobanksin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** suyjzkrqhbqnca-lsdhhaiusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 271.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-7648]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-pinobanksin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=271.249}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-6992
- common-name:
- (+)-pinobanksin
- smiles:
- c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
- inchi-key:
- suyjzkrqhbqnca-lsdhhaiusa-m
- molecular-weight:
- 271.249
