Difference between revisions of "CPD-6992"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22198 == * transcription-direction: ** negative * right-end-position: ** 132254 * left-end-position: ** 112917 * centisome-position: ** 62.900448...")
 
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) * inchi-key: ** suyjzkrqhbq...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22198 ==
+
== Metabolite CPD-6992 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (+)-pinobanksin
−
* right-end-position:
+
* smiles:
−
** 132254
+
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
−
* left-end-position:
+
* inchi-key:
−
** 112917
+
** suyjzkrqhbqnca-lsdhhaiusa-m
−
* centisome-position:
+
* molecular-weight:
−
** 62.900448   
+
** 271.249
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-7648]]
−
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(+)-pinobanksin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=271.249}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN66-579]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4661]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6372]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-2301]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6664]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6580]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY1G-0]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=132254}}
 
−
{{#set: left-end-position=112917}}
 
−
{{#set: centisome-position=62.900448    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-6992

  • common-name:
    • (+)-pinobanksin
  • smiles:
    • c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
  • inchi-key:
    • suyjzkrqhbqnca-lsdhhaiusa-m
  • molecular-weight:
    • 271.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-6992&oldid=137218"