Difference between revisions of "CPD-6992"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite BCCP-biotin-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTARYL-COA ==
+
== Metabolite BCCP-biotin-L-lysine ==
 
* common-name:
 
* common-name:
** glutaryl-coa
+
** a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** sykwlijqehrdnh-ckrmaksasa-i
 
* molecular-weight:
 
** 876.595
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-8032]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* [[BIOTINLIG-RXN]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-8032]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutaryl-coa}}
+
{{#set: common-name=a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine}}
{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}
 
{{#set: molecular-weight=876.595}}
 

Revision as of 14:54, 5 January 2021

Metabolite BCCP-biotin-L-lysine

  • common-name:
    • a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.