Difference between revisions of "CPD-6993"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1603 RXN0-1603] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-9700 == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) * inchi-key: ** uydzycpiqsrxku-n...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9700 == |
| − | * | + | * common-name: |
| − | ** | + | ** hypoglycin b |
| − | * | + | * smiles: |
| − | ** | + | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) |
| − | = | + | * inchi-key: |
| − | + | ** uydzycpiqsrxku-nppuscpjsa-m | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 269.277 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-9157]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | ** | + | {{#set: common-name=hypoglycin b}} |
| − | == | + | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} |
| − | == | + | {{#set: molecular-weight=269.277}} |
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-9700
- common-name:
- hypoglycin b
- smiles:
- c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
- inchi-key:
- uydzycpiqsrxku-nppuscpjsa-m
- molecular-weight:
- 269.277
