Difference between revisions of "CPD-6993"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
+
== Metabolite CPD-6993 ==
 
* common-name:
 
* common-name:
** 2,4-dinitrophenyl-s-glutathione
+
** pinocembrin chalcone
 
* smiles:
 
* smiles:
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
+
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 
* inchi-key:
 
* inchi-key:
** fxeukvkgtkddiq-uwvggrqhsa-m
+
** loyxtwzxlwhmbx-votsokgwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 472.406
+
** 256.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
+
* [[RXN-7647]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
+
* [[RXN-7645]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
+
{{#set: common-name=pinocembrin chalcone}}
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
+
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
{{#set: molecular-weight=472.406}}
+
{{#set: molecular-weight=256.257}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-6993

  • common-name:
    • pinocembrin chalcone
  • smiles:
    • c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
  • inchi-key:
    • loyxtwzxlwhmbx-votsokgwsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality