Difference between revisions of "CPD-6994"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3188 == * common-name: ** n'-hydroxymethyl-norcotinine * smiles: ** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2)) * inchi-key: ** gqufobhepvfqm...") |
(Created page with "Category:metabolite == Metabolite CPD-6994 == * common-name: ** (2s)-eriodictyol * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) * inchi-key: ** sbhxy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-6994 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-eriodictyol |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sbhxytngizcorc-zdusscgksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 287.248 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7775]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-eriodictyol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbhxytngizcorc-zdusscgksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=287.248}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-6994
- common-name:
- (2s)-eriodictyol
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o)
- inchi-key:
- sbhxytngizcorc-zdusscgksa-m
- molecular-weight:
- 287.248
