|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] == | + | == Metabolite CPD-6994 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** (s)-3-hydroxypalmitoyl-coa oxidoreductase | + | ** (2s)-eriodictyol |
| − | ** long-chain-3-hydroxyacyl-coa dehydrogenase | + | * smiles: |
| − | * ec-number:
| + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.211 ec-1.1.1.211] | + | * inchi-key: |
| − | == Reaction formula == | + | ** sbhxytngizcorc-zdusscgksa-m |
| − | * 1 [[CPD0-2232]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[3-OXOPALMITOYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 287.248 |
| − | * Gene: [[SJ21390]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-7775]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=(2s)-eriodictyol}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=sbhxytngizcorc-zdusscgksa-m}} |
| − | * Gene: [[SJ07211]]
| + | {{#set: molecular-weight=287.248}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ03584]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ16470]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656] | |
| − | ** '''4''' reactions found over '''22''' reactions in the full pathway
| |
| − | * [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
| |
| − | ** '''5''' reactions found over '''11''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31160 31160]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04737 R04737]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=long-chain-3-hydroxyacyl-coa dehydrogenase|(s)-3-hydroxypalmitoyl-coa oxidoreductase}} | |
| − | {{#set: ec-number=ec-1.1.1.211}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
| |
