Difference between revisions of "CPD-700"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
(Created page with "Category:metabolite == Metabolite CPD-700 == * common-name: ** ergosta-5,7,24(28)-trien-3β-ol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2cc...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-700 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** ergosta-5,7,24(28)-trien-3β-ol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zepnvcgpjxyabb-loioqlkmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 396.655 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-707]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3O-218]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=ergosta-5,7,24(28)-trien-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zepnvcgpjxyabb-loioqlkmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=396.655}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-700
- common-name:
- ergosta-5,7,24(28)-trien-3β-ol
- smiles:
- cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- zepnvcgpjxyabb-loioqlkmsa-n
- molecular-weight:
- 396.655
