Difference between revisions of "CPD-7002"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-69 == * common-name: ** cyanate * smiles: ** c([o-])#n * inchi-key: ** xljmaioerfsogz-uhfffaoysa-m * molecular-weight: ** 42.017 == R...")
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-69 ==
+
== Metabolite CPD-7002 ==
 
* common-name:
 
* common-name:
** cyanate
+
** dihydrogeranylgeranyl diphosphate
 
* smiles:
 
* smiles:
** c([o-])#n
+
** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
* inchi-key:
** xljmaioerfsogz-uhfffaoysa-m
+
** yjganofpasczbk-wcnzlwbosa-k
 
* molecular-weight:
 
* molecular-weight:
** 42.017
+
** 449.44
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R524-RXN]]
+
* [[RXN-7658]]
* [[RXN-12893]]
+
* [[RXN-7659]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7658]]
 +
* [[RXN-7659]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyanate}}
+
{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
{{#set: inchi-key=inchikey=xljmaioerfsogz-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
{{#set: molecular-weight=42.017}}
+
{{#set: molecular-weight=449.44}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-7002

  • common-name:
    • dihydrogeranylgeranyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
  • inchi-key:
    • yjganofpasczbk-wcnzlwbosa-k
  • molecular-weight:
    • 449.44

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality