Difference between revisions of "CPD-7002"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21981 == * transcription-direction: ** positive * right-end-position: ** 473667 * left-end-position: ** 469992 * centisome-position: ** 80.05833...")
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21981 ==
+
== Metabolite CPD-9868 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-(all-trans-nonaprenyl)benzene-1,2-diol
−
* right-end-position:
+
* smiles:
−
** 473667
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 469992
+
** pkyzmvivzpjxfm-xbvqzqhusa-n
−
* centisome-position:
+
* molecular-weight:
−
** 80.05833   
+
** 723.176
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9240]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ACETYLORNDEACET-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=723.176}}
−
* [[AMINOACYLASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13684]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[GLUTORN-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=473667}}
 
−
{{#set: left-end-position=469992}}
 
−
{{#set: centisome-position=80.05833    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-9868

  • common-name:
    • 3-(all-trans-nonaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • pkyzmvivzpjxfm-xbvqzqhusa-n
  • molecular-weight:
    • 723.176

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7002&oldid=46398"