Difference between revisions of "CPD-7002"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
(Created page with "Category:metabolite == Metabolite CPD-7158 == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7158 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** 3-demethylubiquinol-9 |
* smiles: | * smiles: | ||
| − | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c( | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** alajatogwwbpqt-nscwjznlsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 783.228 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.1.1.64-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=3-demethylubiquinol-9}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=783.228}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-7158
- common-name:
- 3-demethylubiquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
- inchi-key:
- alajatogwwbpqt-nscwjznlsa-n
- molecular-weight:
- 783.228
