Difference between revisions of "CPD-7003"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Peptide-3-hydroxy-L-Aspartates == * common-name: ** a [protein]-3-hydroxy-l-aspartate == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7003 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
| + | * smiles: | ||
| + | ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** vzbgwadxujsbti-pyddkjgssa-k | ||
| + | * molecular-weight: | ||
| + | ** 451.456 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7659]] | ||
| + | * [[RXN-7660]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7659]] |
| + | * [[RXN-7660]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetrahydrogeranylgeranyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}} | ||
| + | {{#set: molecular-weight=451.456}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7003
- common-name:
- tetrahydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- vzbgwadxujsbti-pyddkjgssa-k
- molecular-weight:
- 451.456
