Difference between revisions of "CPD-7003"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...") |
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7003 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vzbgwadxujsbti-pyddkjgssa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 451.456 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7659]] |
| + | * [[RXN-7660]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7659]] |
| − | * [[RXN- | + | * [[RXN-7660]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetrahydrogeranylgeranyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=451.456}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7003
- common-name:
- tetrahydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- vzbgwadxujsbti-pyddkjgssa-k
- molecular-weight:
- 451.456
